C11H18FN3O4S2 — CID 106335878
3-(aminomethyl)-N-[2-(ethylsulfamoyl)ethyl]-4-fluorobenzenesulfonamide (PubChem CID 106335878) has the molecular formula C11H18FN3O4S2 and a molecular weight of 339.41 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[2-(ethylsulfamoyl)ethyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-N-[2-(ethylsulfamoyl)ethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106335878 |
| Molecular Formula | C11H18FN3O4S2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-(aminomethyl)-N-[2-(ethylsulfamoyl)ethyl]-4-fluorobenzenesulfonamide |
| SMILES | CCNS(=O)(=O)CCNS(=O)(=O)c1ccc(F)c(CN)c1 |
| InChI | InChI=1S/C11H18FN3O4S2/c1-2-14-20(16,17)6-5-15-21(18,19)10-3-4-11(12)9(7-10)8-13/h3-4,7,14-15H,2,5-6,8,13H2,1H3 |
| InChIKey | QHWCLZUZQPJBJC-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |