C12H20N2O5S2 — CID 106341929
N-[2-(ethylsulfamoyl)ethyl]-4-(1-hydroxyethyl)benzenesulfonamide (PubChem CID 106341929) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[2-(ethylsulfamoyl)ethyl]-4-(1-hydroxyethyl)benzenesulfonamide.
| Compound Name | N-[2-(ethylsulfamoyl)ethyl]-4-(1-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106341929 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-[2-(ethylsulfamoyl)ethyl]-4-(1-hydroxyethyl)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)CCNS(=O)(=O)c1ccc(C(C)O)cc1 |
| InChI | InChI=1S/C12H20N2O5S2/c1-3-13-20(16,17)9-8-14-21(18,19)12-6-4-11(5-7-12)10(2)15/h4-7,10,13-15H,3,8-9H2,1-2H3 |
| InChIKey | QPGNNKHXEMOTQX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |