C15H14F2O4S — CID 109415459
1-(2,4-difluorophenyl)-2-(4-methylsulfonylphenoxy)ethanol (PubChem CID 109415459) has the molecular formula C15H14F2O4S and a molecular weight of 328.34 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(4-methylsulfonylphenoxy)ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-(4-methylsulfonylphenoxy)ethanol |
|---|---|
| PubChem CID | 109415459 |
| Molecular Formula | C15H14F2O4S |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(4-methylsulfonylphenoxy)ethanol |
| SMILES | CS(=O)(=O)c1ccc(OCC(O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C15H14F2O4S/c1-22(19,20)12-5-3-11(4-6-12)21-9-15(18)13-7-2-10(16)8-14(13)17/h2-8,15,18H,9H2,1H3 |
| InChIKey | FKQRTBSGZYLMBL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |