C17H16F2O3 — CID 109413353
1-[4-[2-(2,5-difluorophenyl)-2-hydroxyethoxy]phenyl]propan-1-one (PubChem CID 109413353) has the molecular formula C17H16F2O3 and a molecular weight of 306.31 g/mol. Its IUPAC name is 1-[4-[2-(2,5-difluorophenyl)-2-hydroxyethoxy]phenyl]propan-1-one.
| Compound Name | 1-[4-[2-(2,5-difluorophenyl)-2-hydroxyethoxy]phenyl]propan-1-one |
|---|---|
| PubChem CID | 109413353 |
| Molecular Formula | C17H16F2O3 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-[4-[2-(2,5-difluorophenyl)-2-hydroxyethoxy]phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(OCC(O)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C17H16F2O3/c1-2-16(20)11-3-6-13(7-4-11)22-10-17(21)14-9-12(18)5-8-15(14)19/h3-9,17,21H,2,10H2,1H3 |
| InChIKey | SRDHMDVBHYTMTM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |