C16H16F2O4 — CID 109415013
1-(2,5-difluorophenyl)-2-(3,5-dimethoxyphenoxy)ethanol (PubChem CID 109415013) has the molecular formula C16H16F2O4 and a molecular weight of 310.30 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(3,5-dimethoxyphenoxy)ethanol.
| Compound Name | 1-(2,5-difluorophenyl)-2-(3,5-dimethoxyphenoxy)ethanol |
|---|---|
| PubChem CID | 109415013 |
| Molecular Formula | C16H16F2O4 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(3,5-dimethoxyphenoxy)ethanol |
| SMILES | COc1cc(OC)cc(OCC(O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C16H16F2O4/c1-20-11-6-12(21-2)8-13(7-11)22-9-16(19)14-5-10(17)3-4-15(14)18/h3-8,16,19H,9H2,1-2H3 |
| InChIKey | KXLSDLMIKWVOSV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |