C15H13F2NO5 — CID 109415751
1-(2,5-difluorophenyl)-2-(2-methoxy-4-nitrophenoxy)ethanol (PubChem CID 109415751) has the molecular formula C15H13F2NO5 and a molecular weight of 325.27 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(2-methoxy-4-nitrophenoxy)ethanol.
| Compound Name | 1-(2,5-difluorophenyl)-2-(2-methoxy-4-nitrophenoxy)ethanol |
|---|---|
| PubChem CID | 109415751 |
| Molecular Formula | C15H13F2NO5 |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(2-methoxy-4-nitrophenoxy)ethanol |
| SMILES | COc1cc([N+](=O)[O-])ccc1OCC(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H13F2NO5/c1-22-15-7-10(18(20)21)3-5-14(15)23-8-13(19)11-6-9(16)2-4-12(11)17/h2-7,13,19H,8H2,1H3 |
| InChIKey | CRKLBLIETRLSCT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|