C14H10F4O2 — CID 109414944
2-(3,4-difluorophenoxy)-1-(2,5-difluorophenyl)ethanol (PubChem CID 109414944) has the molecular formula C14H10F4O2 and a molecular weight of 286.22 g/mol. Its IUPAC name is 2-(3,4-difluorophenoxy)-1-(2,5-difluorophenyl)ethanol.
| Compound Name | 2-(3,4-difluorophenoxy)-1-(2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 109414944 |
| Molecular Formula | C14H10F4O2 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(3,4-difluorophenoxy)-1-(2,5-difluorophenyl)ethanol |
| SMILES | OC(COc1ccc(F)c(F)c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H10F4O2/c15-8-1-3-11(16)10(5-8)14(19)7-20-9-2-4-12(17)13(18)6-9/h1-6,14,19H,7H2 |
| InChIKey | HLFVHUAAUIOJOU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |