C15H15F2NO2 — CID 43554706
1-[4-(aminomethyl)phenyl]-2-(3,4-difluorophenoxy)ethanol (PubChem CID 43554706) has the molecular formula C15H15F2NO2 and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]-2-(3,4-difluorophenoxy)ethanol.
| Compound Name | 1-[4-(aminomethyl)phenyl]-2-(3,4-difluorophenoxy)ethanol |
|---|---|
| PubChem CID | 43554706 |
| Molecular Formula | C15H15F2NO2 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]-2-(3,4-difluorophenoxy)ethanol |
| SMILES | NCc1ccc(C(O)COc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H15F2NO2/c16-13-6-5-12(7-14(13)17)20-9-15(19)11-3-1-10(8-18)2-4-11/h1-7,15,19H,8-9,18H2 |
| InChIKey | GBOABIPOLYDISG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |