C14H13F2NO — CID 43554727
[3-[(3,4-difluorophenoxy)methyl]phenyl]methanamine (PubChem CID 43554727) has the molecular formula C14H13F2NO and a molecular weight of 249.26 g/mol. Its IUPAC name is [3-[(3,4-difluorophenoxy)methyl]phenyl]methanamine.
| Compound Name | [3-[(3,4-difluorophenoxy)methyl]phenyl]methanamine |
|---|---|
| PubChem CID | 43554727 |
| Molecular Formula | C14H13F2NO |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | [3-[(3,4-difluorophenoxy)methyl]phenyl]methanamine |
| SMILES | NCc1cccc(COc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C14H13F2NO/c15-13-5-4-12(7-14(13)16)18-9-11-3-1-2-10(6-11)8-17/h1-7H,8-9,17H2 |
| InChIKey | QUOFVXNFZMUJJS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |