C28H27NO3 — CID 20685429
4-[[4-[[3-[[4-(aminomethyl)phenoxy]methyl]phenyl]methoxy]phenyl]methyl]phenol (PubChem CID 20685429) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-[[4-[[3-[[4-(aminomethyl)phenoxy]methyl]phenyl]methoxy]phenyl]methyl]phenol.
| Compound Name | 4-[[4-[[3-[[4-(aminomethyl)phenoxy]methyl]phenyl]methoxy]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 20685429 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 4-[[4-[[3-[[4-(aminomethyl)phenoxy]methyl]phenyl]methoxy]phenyl]methyl]phenol |
| SMILES | NCc1ccc(OCc2cccc(COc3ccc(Cc4ccc(O)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C28H27NO3/c29-18-23-8-14-28(15-9-23)32-20-25-3-1-2-24(17-25)19-31-27-12-6-22(7-13-27)16-21-4-10-26(30)11-5-21/h1-15,17,30H,16,18-20,29H2 |
| InChIKey | WMGUMMQZWKHDRZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |