C14H14F2N2 — CID 116937056
[4-(aminomethyl)phenyl]-(3,4-difluorophenyl)methanamine (PubChem CID 116937056) has the molecular formula C14H14F2N2 and a molecular weight of 248.28 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]-(3,4-difluorophenyl)methanamine.
| Compound Name | [4-(aminomethyl)phenyl]-(3,4-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 116937056 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | [4-(aminomethyl)phenyl]-(3,4-difluorophenyl)methanamine |
| SMILES | NCc1ccc(C(N)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C14H14F2N2/c15-12-6-5-11(7-13(12)16)14(18)10-3-1-9(8-17)2-4-10/h1-7,14H,8,17-18H2 |
| InChIKey | ACIARLIEJIYNTD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |