3-[amino-(3,4-difluorophenyl)methyl]benzoic acid

C14H11F2NO2 — CID 116938711

IUPAC3-[amino-(3,4-difluorophenyl)methyl]benzoic acid
SMILESNC(c1cccc(C(=O)O)c1)c1ccc(F)c(F)c1
InChIInChI=1S/C14H11F2NO2/c15-11-5-4-9(7-12(11)16)13(17)8-2-1-3-10(6-8)14(18)19/h1-7,13H,17H2,(H,18,19)
InChIKeyKPYJEEUBYQLIFR-UHFFFAOYSA-N
MW263.24 g/mol
LogP2.71
Rot. Bonds3

About 3-[amino-(3,4-difluorophenyl)methyl]benzoic acid

3-[amino-(3,4-difluorophenyl)methyl]benzoic acid (PubChem CID 116938711) has the molecular formula C14H11F2NO2 and a molecular weight of 263.24 g/mol. Its IUPAC name is 3-[amino-(3,4-difluorophenyl)methyl]benzoic acid.

Molecular Properties

Compound Name3-[amino-(3,4-difluorophenyl)methyl]benzoic acid
PubChem CID116938711
Molecular FormulaC14H11F2NO2
Molecular Weight263.24 g/mol
Exact Mass263.08
IUPAC Name3-[amino-(3,4-difluorophenyl)methyl]benzoic acid
SMILESNC(c1cccc(C(=O)O)c1)c1ccc(F)c(F)c1
InChIInChI=1S/C14H11F2NO2/c15-11-5-4-9(7-12(11)16)13(17)8-2-1-3-10(6-8)14(18)19/h1-7,13H,17H2,(H,18,19)
InChIKeyKPYJEEUBYQLIFR-UHFFFAOYSA-N
XLogP2.71
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.24
LogP ≤ 52.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[amino-(3,4-difluorophenyl)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[amino-(3,4-difluorophenyl)methyl]benzoic acid?
The IUPAC name of 3-[amino-(3,4-difluorophenyl)methyl]benzoic acid (CID 116938711) is 3-[amino-(3,4-difluorophenyl)methyl]benzoic acid.
What is the SMILES notation for 3-[amino-(3,4-difluorophenyl)methyl]benzoic acid?
The canonical SMILES for 3-[amino-(3,4-difluorophenyl)methyl]benzoic acid is NC(c1cccc(C(=O)O)c1)c1ccc(F)c(F)c1.
What is the InChIKey of 3-[amino-(3,4-difluorophenyl)methyl]benzoic acid?
The InChIKey is KPYJEEUBYQLIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2NO2/c15-11-5-4-9(7-12(11)16)13(17)8-2-1-3-10(6-8)14(18)19/h1-7,13H,17H2,(H,18,19).
What are the key properties of 3-[amino-(3,4-difluorophenyl)methyl]benzoic acid?
3-[amino-(3,4-difluorophenyl)methyl]benzoic acid has a molecular weight of 263.24 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[amino-(3,4-difluorophenyl)methyl]benzoic acid is sourced from PubChem (CID 116938711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).