C14H12F4N2 — CID 124654147
(1R,2S)-1,2-bis(3,4-difluorophenyl)ethane-1,2-diamine (PubChem CID 124654147) has the molecular formula C14H12F4N2 and a molecular weight of 284.26 g/mol. Its IUPAC name is (1R,2S)-1,2-bis(3,4-difluorophenyl)ethane-1,2-diamine.
| Compound Name | (1R,2S)-1,2-bis(3,4-difluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 124654147 |
| Molecular Formula | C14H12F4N2 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (1R,2S)-1,2-bis(3,4-difluorophenyl)ethane-1,2-diamine |
| SMILES | N[C@H](c1ccc(F)c(F)c1)[C@@H](N)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H12F4N2/c15-9-3-1-7(5-11(9)17)13(19)14(20)8-2-4-10(16)12(18)6-8/h1-6,13-14H,19-20H2/t13-,14+ |
| InChIKey | JAHUVZNVYIGQKH-OKILXGFUSA-N |
| XLogP | 2.94 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |