C20H27F2NOSi — CID 66873509
[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-(3,4-difluorophenyl)methanamine (PubChem CID 66873509) has the molecular formula C20H27F2NOSi and a molecular weight of 363.52 g/mol. Its IUPAC name is [4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-(3,4-difluorophenyl)methanamine.
| Compound Name | [4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-(3,4-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 66873509 |
| Molecular Formula | C20H27F2NOSi |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-(3,4-difluorophenyl)methanamine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(C(N)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H27F2NOSi/c1-20(2,3)25(4,5)24-13-14-6-8-15(9-7-14)19(23)16-10-11-17(21)18(22)12-16/h6-12,19H,13,23H2,1-5H3 |
| InChIKey | ALWPMFPRDRSKEK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|