C14H22O4S — CID 59667958
(2R)-4,4-dimethyl-1-(4-methylsulfonylphenoxy)pentan-2-ol (PubChem CID 59667958) has the molecular formula C14H22O4S and a molecular weight of 286.39 g/mol. Its IUPAC name is (2R)-4,4-dimethyl-1-(4-methylsulfonylphenoxy)pentan-2-ol.
| Compound Name | (2R)-4,4-dimethyl-1-(4-methylsulfonylphenoxy)pentan-2-ol |
|---|---|
| PubChem CID | 59667958 |
| Molecular Formula | C14H22O4S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2R)-4,4-dimethyl-1-(4-methylsulfonylphenoxy)pentan-2-ol |
| SMILES | CC(C)(C)C[C@@H](O)COc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H22O4S/c1-14(2,3)9-11(15)10-18-12-5-7-13(8-6-12)19(4,16)17/h5-8,11,15H,9-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | ZLHCBTZKCVIFRD-LLVKDONJSA-N |
| XLogP | 2.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |