C19H31NO4S — CID 164906220
1-[2-(2-methylpropyl)piperidin-1-yl]-3-(4-methylsulfonylphenoxy)propan-2-ol (PubChem CID 164906220) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is 1-[2-(2-methylpropyl)piperidin-1-yl]-3-(4-methylsulfonylphenoxy)propan-2-ol.
| Compound Name | 1-[2-(2-methylpropyl)piperidin-1-yl]-3-(4-methylsulfonylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 164906220 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1-[2-(2-methylpropyl)piperidin-1-yl]-3-(4-methylsulfonylphenoxy)propan-2-ol |
| SMILES | CC(C)CC1CCCCN1CC(O)COc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H31NO4S/c1-15(2)12-16-6-4-5-11-20(16)13-17(21)14-24-18-7-9-19(10-8-18)25(3,22)23/h7-10,15-17,21H,4-6,11-14H2,1-3H3 |
| InChIKey | BTDBTDWHDUZIQR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |