C20H32N2O3 — CID 111114259
1-(4-methylphenoxy)-3-[2-(morpholin-4-ylmethyl)piperidin-1-yl]propan-2-ol (PubChem CID 111114259) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-(4-methylphenoxy)-3-[2-(morpholin-4-ylmethyl)piperidin-1-yl]propan-2-ol.
| Compound Name | 1-(4-methylphenoxy)-3-[2-(morpholin-4-ylmethyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 111114259 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 1-(4-methylphenoxy)-3-[2-(morpholin-4-ylmethyl)piperidin-1-yl]propan-2-ol |
| SMILES | Cc1ccc(OCC(O)CN2CCCCC2CN2CCOCC2)cc1 |
| InChI | InChI=1S/C20H32N2O3/c1-17-5-7-20(8-6-17)25-16-19(23)15-22-9-3-2-4-18(22)14-21-10-12-24-13-11-21/h5-8,18-19,23H,2-4,9-16H2,1H3 |
| InChIKey | NKVQLVYBUAHVJR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |