C15H23Cl2NO3 — CID 44782330
1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol;hydrochloride (PubChem CID 44782330) has the molecular formula C15H23Cl2NO3 and a molecular weight of 336.26 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol;hydrochloride.
| Compound Name | 1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 44782330 |
| Molecular Formula | C15H23Cl2NO3 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol;hydrochloride |
| SMILES | Cl.OCC1CCCCN1CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H22ClNO3.ClH/c16-12-4-6-15(7-5-12)20-11-14(19)9-17-8-2-1-3-13(17)10-18;/h4-7,13-14,18-19H,1-3,8-11H2;1H |
| InChIKey | KMSPEGVTUUGNMW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |