C18H29NO3 — CID 110921385
1-(4-tert-butylphenoxy)-3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propan-2-ol (PubChem CID 110921385) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 1-(4-tert-butylphenoxy)-3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propan-2-ol.
| Compound Name | 1-(4-tert-butylphenoxy)-3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 110921385 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 1-(4-tert-butylphenoxy)-3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propan-2-ol |
| SMILES | CC(C)(C)c1ccc(OCC(O)CN2CCC[C@@H]2CO)cc1 |
| InChI | InChI=1S/C18H29NO3/c1-18(2,3)14-6-8-17(9-7-14)22-13-16(21)11-19-10-4-5-15(19)12-20/h6-9,15-16,20-21H,4-5,10-13H2,1-3H3/t15-,16?/m1/s1 |
| InChIKey | BVUPVIVWZYBVBO-AAFJCEBUSA-N |
| XLogP | 2.18 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |