C18H23NO3 — CID 111103265
1-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-naphthalen-1-yloxypropan-2-ol (PubChem CID 111103265) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-naphthalen-1-yloxypropan-2-ol.
| Compound Name | 1-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-naphthalen-1-yloxypropan-2-ol |
|---|---|
| PubChem CID | 111103265 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-naphthalen-1-yloxypropan-2-ol |
| SMILES | OCC1CCCN1CC(O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C18H23NO3/c20-12-15-7-4-10-19(15)11-16(21)13-22-18-9-3-6-14-5-1-2-8-17(14)18/h1-3,5-6,8-9,15-16,20-21H,4,7,10-13H2 |
| InChIKey | DXZKXXUZKROCOI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |