C23H25NO2 — CID 100856123
(2R)-1-naphthalen-1-yloxy-3-[(3S)-3-phenylpyrrolidin-1-yl]propan-2-ol (PubChem CID 100856123) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (2R)-1-naphthalen-1-yloxy-3-[(3S)-3-phenylpyrrolidin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-naphthalen-1-yloxy-3-[(3S)-3-phenylpyrrolidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 100856123 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (2R)-1-naphthalen-1-yloxy-3-[(3S)-3-phenylpyrrolidin-1-yl]propan-2-ol |
| SMILES | O[C@@H](COc1cccc2ccccc12)CN1CC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H25NO2/c25-21(16-24-14-13-20(15-24)18-7-2-1-3-8-18)17-26-23-12-6-10-19-9-4-5-11-22(19)23/h1-12,20-21,25H,13-17H2/t20-,21-/m1/s1 |
| InChIKey | OWLWGTWFFKUJNX-NHCUHLMSSA-N |
| XLogP | 4.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |