C27H28N2O4 — CID 22729075
4-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1H-indole-2-carboxylic acid (PubChem CID 22729075) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 4-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1H-indole-2-carboxylic acid.
| Compound Name | 4-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 22729075 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(OCC(O)CN3CCC(c4ccc5ccccc5c4)CC3)cccc2[nH]1 |
| InChI | InChI=1S/C27H28N2O4/c30-22(17-33-26-7-3-6-24-23(26)15-25(28-24)27(31)32)16-29-12-10-19(11-13-29)21-9-8-18-4-1-2-5-20(18)14-21/h1-9,14-15,19,22,28,30H,10-13,16-17H2,(H,31,32) |
| InChIKey | UDDFRWOIMIWPEH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |