C29H34N2O4 — CID 139825583
3-[2-[(2S)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-N-methoxy-N-methylprop-2-enamide (PubChem CID 139825583) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is 3-[2-[(2S)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-N-methoxy-N-methylprop-2-enamide.
| Compound Name | 3-[2-[(2S)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-N-methoxy-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 139825583 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 3-[2-[(2S)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-N-methoxy-N-methylprop-2-enamide |
| SMILES | CON(C)C(=O)C=Cc1ccccc1OC[C@@H](O)CN1CCC(c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C29H34N2O4/c1-30(34-2)29(33)14-13-24-8-5-6-10-28(24)35-21-27(32)20-31-17-15-23(16-18-31)26-12-11-22-7-3-4-9-25(22)19-26/h3-14,19,23,27,32H,15-18,20-21H2,1-2H3/t27-/m0/s1 |
| InChIKey | QHLUXTOMQDRZNG-MHZLTWQESA-N |
| XLogP | 4.49 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|