C32H38N2O5 — CID 139825630
3-[2-[2-hydroxy-3-[4-(6-methoxynaphthalen-2-yl)piperidin-1-yl]propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 139825630) has the molecular formula C32H38N2O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is 3-[2-[2-hydroxy-3-[4-(6-methoxynaphthalen-2-yl)piperidin-1-yl]propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | 3-[2-[2-hydroxy-3-[4-(6-methoxynaphthalen-2-yl)piperidin-1-yl]propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 139825630 |
| Molecular Formula | C32H38N2O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 3-[2-[2-hydroxy-3-[4-(6-methoxynaphthalen-2-yl)piperidin-1-yl]propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | COc1ccc2cc(C3CCN(CC(O)COc4ccccc4C=CC(=O)N4CCOCC4)CC3)ccc2c1 |
| InChI | InChI=1S/C32H38N2O5/c1-37-30-10-8-27-20-26(6-7-28(27)21-30)24-12-14-33(15-13-24)22-29(35)23-39-31-5-3-2-4-25(31)9-11-32(36)34-16-18-38-19-17-34/h2-11,20-21,24,29,35H,12-19,22-23H2,1H3 |
| InChIKey | QUSQSSXHYDSUJU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|