C27H33BrN2O4 — CID 139825524
3-[2-[3-[4-(4-bromophenyl)piperidin-1-yl]-2-hydroxypropoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 139825524) has the molecular formula C27H33BrN2O4 and a molecular weight of 529.48 g/mol. Its IUPAC name is 3-[2-[3-[4-(4-bromophenyl)piperidin-1-yl]-2-hydroxypropoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | 3-[2-[3-[4-(4-bromophenyl)piperidin-1-yl]-2-hydroxypropoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 139825524 |
| Molecular Formula | C27H33BrN2O4 |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 3-[2-[3-[4-(4-bromophenyl)piperidin-1-yl]-2-hydroxypropoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1OCC(O)CN1CCC(c2ccc(Br)cc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C27H33BrN2O4/c28-24-8-5-21(6-9-24)22-11-13-29(14-12-22)19-25(31)20-34-26-4-2-1-3-23(26)7-10-27(32)30-15-17-33-18-16-30/h1-10,22,25,31H,11-20H2 |
| InChIKey | NNRCUMPGDOCONF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|