C34H36N2O3 — CID 11477925
(E)-3-[2-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-N-methyl-N-phenylprop-2-enamide (PubChem CID 11477925) has the molecular formula C34H36N2O3 and a molecular weight of 520.67 g/mol. Its IUPAC name is (E)-3-[2-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-N-methyl-N-phenylprop-2-enamide.
| Compound Name | (E)-3-[2-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-N-methyl-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 11477925 |
| Molecular Formula | C34H36N2O3 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | (E)-3-[2-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-N-methyl-N-phenylprop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1ccccc1OCC(O)CN1CCC(c2ccc3ccccc3c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C34H36N2O3/c1-35(31-12-3-2-4-13-31)34(38)18-17-28-10-7-8-14-33(28)39-25-32(37)24-36-21-19-27(20-22-36)30-16-15-26-9-5-6-11-29(26)23-30/h2-18,23,27,32,37H,19-22,24-25H2,1H3/b18-17+ |
| InChIKey | ZXURMRFAXFYMAD-ISLYRVAYSA-N |
| XLogP | 6.14 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|