C29H32N2O3 — CID 18446034
(3Z)-3-[[2-[(2S)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]methylidene]pyrrolidin-2-one (PubChem CID 18446034) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is (3Z)-3-[[2-[(2S)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]methylidene]pyrrolidin-2-one.
| Compound Name | (3Z)-3-[[2-[(2S)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]methylidene]pyrrolidin-2-one |
|---|---|
| PubChem CID | 18446034 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (3Z)-3-[[2-[(2S)-2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]methylidene]pyrrolidin-2-one |
| SMILES | O=C1NCC/C1=C/c1ccccc1OC[C@@H](O)CN1CCC(c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C29H32N2O3/c32-27(20-34-28-8-4-3-7-25(28)18-26-11-14-30-29(26)33)19-31-15-12-22(13-16-31)24-10-9-21-5-1-2-6-23(21)17-24/h1-10,17-18,22,27,32H,11-16,19-20H2,(H,30,33)/b26-18-/t27-/m0/s1 |
| InChIKey | VAEKXAAGWKEORA-QXEJOFBLSA-N |
| XLogP | 4.36 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|