C31H36N2O3 — CID 139825531
3-[3-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 139825531) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is 3-[3-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 3-[3-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 139825531 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 3-[3-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc(OCC(O)CN2CCC(c3ccc4ccccc4c3)CC2)c1)N1CCCC1 |
| InChI | InChI=1S/C31H36N2O3/c34-29(23-36-30-9-5-6-24(20-30)10-13-31(35)33-16-3-4-17-33)22-32-18-14-26(15-19-32)28-12-11-25-7-1-2-8-27(25)21-28/h1-2,5-13,20-21,26,29,34H,3-4,14-19,22-23H2 |
| InChIKey | DARHPUDGPSIJAH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|