C32H38N2O4 — CID 139825703
3-[2-[2-methoxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 139825703) has the molecular formula C32H38N2O4 and a molecular weight of 514.67 g/mol. Its IUPAC name is 3-[2-[2-methoxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | 3-[2-[2-methoxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 139825703 |
| Molecular Formula | C32H38N2O4 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 3-[2-[2-methoxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | COC(COc1ccccc1C=CC(=O)N1CCOCC1)CN1CCC(c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C32H38N2O4/c1-36-30(23-33-16-14-26(15-17-33)29-11-10-25-6-2-3-8-28(25)22-29)24-38-31-9-5-4-7-27(31)12-13-32(35)34-18-20-37-21-19-34/h2-13,22,26,30H,14-21,23-24H2,1H3 |
| InChIKey | JVXBHOHTHUYXCZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|