C28H33F3N2O4 — CID 139825502
3-[2-[2-hydroxy-3-[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 139825502) has the molecular formula C28H33F3N2O4 and a molecular weight of 518.58 g/mol. Its IUPAC name is 3-[2-[2-hydroxy-3-[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | 3-[2-[2-hydroxy-3-[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 139825502 |
| Molecular Formula | C28H33F3N2O4 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 3-[2-[2-hydroxy-3-[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]propoxy]phenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1OCC(O)CN1CCC(c2cccc(C(F)(F)F)c2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C28H33F3N2O4/c29-28(30,31)24-6-3-5-23(18-24)21-10-12-32(13-11-21)19-25(34)20-37-26-7-2-1-4-22(26)8-9-27(35)33-14-16-36-17-15-33/h1-9,18,21,25,34H,10-17,19-20H2 |
| InChIKey | VHZPCLQGJTZBMU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|