C28H35ClN2O3 — CID 139825543
3-[2-[3-[4-(4-chloro-2-methylphenyl)piperidin-1-yl]-2-hydroxypropoxy]phenyl]-1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 139825543) has the molecular formula C28H35ClN2O3 and a molecular weight of 483.05 g/mol. Its IUPAC name is 3-[2-[3-[4-(4-chloro-2-methylphenyl)piperidin-1-yl]-2-hydroxypropoxy]phenyl]-1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 3-[2-[3-[4-(4-chloro-2-methylphenyl)piperidin-1-yl]-2-hydroxypropoxy]phenyl]-1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 139825543 |
| Molecular Formula | C28H35ClN2O3 |
| Molecular Weight | 483.05 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 3-[2-[3-[4-(4-chloro-2-methylphenyl)piperidin-1-yl]-2-hydroxypropoxy]phenyl]-1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | Cc1cc(Cl)ccc1C1CCN(CC(O)COc2ccccc2C=CC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C28H35ClN2O3/c1-21-18-24(29)9-10-26(21)22-12-16-30(17-13-22)19-25(32)20-34-27-7-3-2-6-23(27)8-11-28(33)31-14-4-5-15-31/h2-3,6-11,18,22,25,32H,4-5,12-17,19-20H2,1H3 |
| InChIKey | WLZIKYZWQRXPDD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.05 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|