C32H39N3O3 — CID 139825508
3-[2-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-(4-methylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 139825508) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is 3-[2-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-(4-methylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | 3-[2-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-(4-methylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139825508 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 3-[2-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]phenyl]-1-(4-methylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | CN1CCN(C(=O)C=Cc2ccccc2OCC(O)CN2CCC(c3ccc4ccccc4c3)CC2)CC1 |
| InChI | InChI=1S/C32H39N3O3/c1-33-18-20-35(21-19-33)32(37)13-12-27-7-4-5-9-31(27)38-24-30(36)23-34-16-14-26(15-17-34)29-11-10-25-6-2-3-8-28(25)22-29/h2-13,22,26,30,36H,14-21,23-24H2,1H3 |
| InChIKey | CNHXQTBUUYZNJJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|