C34H43N2O4+ — CID 91117226
ethyl (1R)-4-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-methyl-1-(2-methylpropyl)indol-1-ium-2-carboxylate (PubChem CID 91117226) has the molecular formula C34H43N2O4+ and a molecular weight of 543.73 g/mol. Its IUPAC name is ethyl (1R)-4-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-methyl-1-(2-methylpropyl)indol-1-ium-2-carboxylate.
| Compound Name | ethyl (1R)-4-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-methyl-1-(2-methylpropyl)indol-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 91117226 |
| Molecular Formula | C34H43N2O4+ |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | ethyl (1R)-4-[2-hydroxy-3-(4-naphthalen-2-ylpiperidin-1-yl)propoxy]-1-methyl-1-(2-methylpropyl)indol-1-ium-2-carboxylate |
| SMILES | CCOC(=O)C1=Cc2c(OCC(O)CN3CCC(c4ccc5ccccc5c4)CC3)cccc2[N@@+]1(C)CC(C)C |
| InChI | InChI=1S/C34H43N2O4/c1-5-39-34(38)32-20-30-31(36(32,4)22-24(2)3)11-8-12-33(30)40-23-29(37)21-35-17-15-26(16-18-35)28-14-13-25-9-6-7-10-27(25)19-28/h6-14,19-20,24,26,29,37H,5,15-18,21-23H2,1-4H3/q+1/t29?,36-/m1/s1 |
| InChIKey | AEGYGUBUHZMCNB-YVSJXSHXSA-N |
| XLogP | 5.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|