C24H28N2O5 — CID 21327275
4-[2-hydroxy-3-[4-(phenoxymethyl)piperidin-1-yl]propoxy]-1H-indole-2-carboxylic acid (PubChem CID 21327275) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[4-(phenoxymethyl)piperidin-1-yl]propoxy]-1H-indole-2-carboxylic acid.
| Compound Name | 4-[2-hydroxy-3-[4-(phenoxymethyl)piperidin-1-yl]propoxy]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 21327275 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 4-[2-hydroxy-3-[4-(phenoxymethyl)piperidin-1-yl]propoxy]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(OCC(O)CN3CCC(COc4ccccc4)CC3)cccc2[nH]1 |
| InChI | InChI=1S/C24H28N2O5/c27-18(16-31-23-8-4-7-21-20(23)13-22(25-21)24(28)29)14-26-11-9-17(10-12-26)15-30-19-5-2-1-3-6-19/h1-8,13,17-18,25,27H,9-12,14-16H2,(H,28,29) |
| InChIKey | KYTKOICHKHPBQK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |