C23H28N2O5 — CID 152625181
4-[[1-[2-hydroxy-3-(1H-indol-4-ylperoxy)propyl]piperidin-4-yl]methoxy]phenol (PubChem CID 152625181) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[[1-[2-hydroxy-3-(1H-indol-4-ylperoxy)propyl]piperidin-4-yl]methoxy]phenol.
| Compound Name | 4-[[1-[2-hydroxy-3-(1H-indol-4-ylperoxy)propyl]piperidin-4-yl]methoxy]phenol |
|---|---|
| PubChem CID | 152625181 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 4-[[1-[2-hydroxy-3-(1H-indol-4-ylperoxy)propyl]piperidin-4-yl]methoxy]phenol |
| SMILES | Oc1ccc(OCC2CCN(CC(O)COOc3cccc4[nH]ccc34)CC2)cc1 |
| InChI | InChI=1S/C23H28N2O5/c26-18-4-6-20(7-5-18)28-15-17-9-12-25(13-10-17)14-19(27)16-29-30-23-3-1-2-22-21(23)8-11-24-22/h1-8,11,17,19,24,26-27H,9-10,12-16H2 |
| InChIKey | ZCJAMWCKPOJQNO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|