C18H24ClNO2 — CID 14556459
1-naphthalen-1-yloxy-3-piperidin-1-ylpropan-2-ol;hydrochloride (PubChem CID 14556459) has the molecular formula C18H24ClNO2 and a molecular weight of 321.85 g/mol. Its IUPAC name is 1-naphthalen-1-yloxy-3-piperidin-1-ylpropan-2-ol;hydrochloride.
| Compound Name | 1-naphthalen-1-yloxy-3-piperidin-1-ylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 14556459 |
| Molecular Formula | C18H24ClNO2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-naphthalen-1-yloxy-3-piperidin-1-ylpropan-2-ol;hydrochloride |
| SMILES | Cl.OC(COc1cccc2ccccc12)CN1CCCCC1 |
| InChI | InChI=1S/C18H23NO2.ClH/c20-16(13-19-11-4-1-5-12-19)14-21-18-10-6-8-15-7-2-3-9-17(15)18;/h2-3,6-10,16,20H,1,4-5,11-14H2;1H |
| InChIKey | PMMVFTJVAUABLF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |