C18H22N2O3 — CID 110882982
1-(2-hydroxy-3-naphthalen-1-yloxypropyl)-1,4-diazepan-5-one (PubChem CID 110882982) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-(2-hydroxy-3-naphthalen-1-yloxypropyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2-hydroxy-3-naphthalen-1-yloxypropyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 110882982 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-(2-hydroxy-3-naphthalen-1-yloxypropyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(CC(O)COc2cccc3ccccc23)CCN1 |
| InChI | InChI=1S/C18H22N2O3/c21-15(12-20-10-8-18(22)19-9-11-20)13-23-17-7-3-5-14-4-1-2-6-16(14)17/h1-7,15,21H,8-13H2,(H,19,22) |
| InChIKey | BMTZBFQYHLLHHS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |