C15H23NO4S — CID 170943532
(2S)-1-ethoxy-2-[(4-methylsulfonylphenoxy)methyl]piperidine (PubChem CID 170943532) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is (2S)-1-ethoxy-2-[(4-methylsulfonylphenoxy)methyl]piperidine.
| Compound Name | (2S)-1-ethoxy-2-[(4-methylsulfonylphenoxy)methyl]piperidine |
|---|---|
| PubChem CID | 170943532 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (2S)-1-ethoxy-2-[(4-methylsulfonylphenoxy)methyl]piperidine |
| SMILES | CCON1CCCC[C@H]1COc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H23NO4S/c1-3-20-16-11-5-4-6-13(16)12-19-14-7-9-15(10-8-14)21(2,17)18/h7-10,13H,3-6,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | SQGQAUOXPQDQHX-ZDUSSCGKSA-N |
| XLogP | 2.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |