C14H23N3O3S — CID 106045444
2-(aminomethyl)-N-(4-ethoxyphenyl)piperidine-1-sulfonamide (PubChem CID 106045444) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(4-ethoxyphenyl)piperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-(4-ethoxyphenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106045444 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-(aminomethyl)-N-(4-ethoxyphenyl)piperidine-1-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)N2CCCCC2CN)cc1 |
| InChI | InChI=1S/C14H23N3O3S/c1-2-20-14-8-6-12(7-9-14)16-21(18,19)17-10-4-3-5-13(17)11-15/h6-9,13,16H,2-5,10-11,15H2,1H3 |
| InChIKey | PYJBUVCMXRDTDH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |