C13H19N3O4S — CID 106023964
2-(aminomethyl)-N-(1,3-benzodioxol-5-yl)piperidine-1-sulfonamide (PubChem CID 106023964) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(1,3-benzodioxol-5-yl)piperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-(1,3-benzodioxol-5-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106023964 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-(aminomethyl)-N-(1,3-benzodioxol-5-yl)piperidine-1-sulfonamide |
| SMILES | NCC1CCCCN1S(=O)(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H19N3O4S/c14-8-11-3-1-2-6-16(11)21(17,18)15-10-4-5-12-13(7-10)20-9-19-12/h4-5,7,11,15H,1-3,6,8-9,14H2 |
| InChIKey | MPRKRWCWDRJMLS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |