C13H19BrFN3O2S — CID 106087812
2-(aminomethyl)-N-(5-bromo-4-fluoro-2-methylphenyl)piperidine-1-sulfonamide (PubChem CID 106087812) has the molecular formula C13H19BrFN3O2S and a molecular weight of 380.28 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(5-bromo-4-fluoro-2-methylphenyl)piperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-(5-bromo-4-fluoro-2-methylphenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106087812 |
| Molecular Formula | C13H19BrFN3O2S |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 2-(aminomethyl)-N-(5-bromo-4-fluoro-2-methylphenyl)piperidine-1-sulfonamide |
| SMILES | Cc1cc(F)c(Br)cc1NS(=O)(=O)N1CCCCC1CN |
| InChI | InChI=1S/C13H19BrFN3O2S/c1-9-6-12(15)11(14)7-13(9)17-21(19,20)18-5-3-2-4-10(18)8-16/h6-7,10,17H,2-5,8,16H2,1H3 |
| InChIKey | UIYGDFPMOHCDLA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |