C12H15BrF2N2O2S — CID 119969412
[1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-2-yl]methanamine (PubChem CID 119969412) has the molecular formula C12H15BrF2N2O2S and a molecular weight of 369.23 g/mol. Its IUPAC name is [1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-2-yl]methanamine.
| Compound Name | [1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 119969412 |
| Molecular Formula | C12H15BrF2N2O2S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | [1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-2-yl]methanamine |
| SMILES | NCC1CCCCN1S(=O)(=O)c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C12H15BrF2N2O2S/c13-9-5-12(11(15)6-10(9)14)20(18,19)17-4-2-1-3-8(17)7-16/h5-6,8H,1-4,7,16H2 |
| InChIKey | GLIZIFHQRSBFAK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|