C13H19BrFN3O2S — CID 106491736
4-bromo-2-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]sulfonyl-5-fluoroaniline (PubChem CID 106491736) has the molecular formula C13H19BrFN3O2S and a molecular weight of 380.28 g/mol. Its IUPAC name is 4-bromo-2-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]sulfonyl-5-fluoroaniline.
| Compound Name | 4-bromo-2-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]sulfonyl-5-fluoroaniline |
|---|---|
| PubChem CID | 106491736 |
| Molecular Formula | C13H19BrFN3O2S |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 4-bromo-2-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]sulfonyl-5-fluoroaniline |
| SMILES | CN(C)CC1CCCN1S(=O)(=O)c1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C13H19BrFN3O2S/c1-17(2)8-9-4-3-5-18(9)21(19,20)13-6-10(14)11(15)7-12(13)16/h6-7,9H,3-5,8,16H2,1-2H3 |
| InChIKey | RANSRHFIWOSUSN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|