C11H14ClF3N2O2S — CID 119988783
[1-(2,4,5-trifluorophenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 119988783) has the molecular formula C11H14ClF3N2O2S and a molecular weight of 330.76 g/mol. Its IUPAC name is [1-(2,4,5-trifluorophenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(2,4,5-trifluorophenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119988783 |
| Molecular Formula | C11H14ClF3N2O2S |
| Molecular Weight | 330.76 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | [1-(2,4,5-trifluorophenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCN1S(=O)(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H13F3N2O2S.ClH/c12-8-4-10(14)11(5-9(8)13)19(17,18)16-3-1-2-7(16)6-15;/h4-5,7H,1-3,6,15H2;1H |
| InChIKey | JIRRSKVPKWJWFP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.76 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|