C12H17BrFN3O2S — CID 106089660
2-(aminomethyl)-N-(2-bromo-6-fluorophenyl)piperidine-1-sulfonamide (PubChem CID 106089660) has the molecular formula C12H17BrFN3O2S and a molecular weight of 366.26 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-bromo-6-fluorophenyl)piperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-(2-bromo-6-fluorophenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106089660 |
| Molecular Formula | C12H17BrFN3O2S |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 2-(aminomethyl)-N-(2-bromo-6-fluorophenyl)piperidine-1-sulfonamide |
| SMILES | NCC1CCCCN1S(=O)(=O)Nc1c(F)cccc1Br |
| InChI | InChI=1S/C12H17BrFN3O2S/c13-10-5-3-6-11(14)12(10)16-20(18,19)17-7-2-1-4-9(17)8-15/h3,5-6,9,16H,1-2,4,7-8,15H2 |
| InChIKey | KFRMHLGGQBNIBU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |