C10H17N3O2S2 — CID 114141613
2-(aminomethyl)-N-thiophen-3-ylpiperidine-1-sulfonamide (PubChem CID 114141613) has the molecular formula C10H17N3O2S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-(aminomethyl)-N-thiophen-3-ylpiperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-thiophen-3-ylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 114141613 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(aminomethyl)-N-thiophen-3-ylpiperidine-1-sulfonamide |
| SMILES | NCC1CCCCN1S(=O)(=O)Nc1ccsc1 |
| InChI | InChI=1S/C10H17N3O2S2/c11-7-10-3-1-2-5-13(10)17(14,15)12-9-4-6-16-8-9/h4,6,8,10,12H,1-3,5,7,11H2 |
| InChIKey | NEEXGEKBYGMNER-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |