C14H23N3O3S — CID 106018354
2-(aminomethyl)-N-(2-phenoxyethyl)piperidine-1-sulfonamide (PubChem CID 106018354) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-phenoxyethyl)piperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-(2-phenoxyethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106018354 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-(aminomethyl)-N-(2-phenoxyethyl)piperidine-1-sulfonamide |
| SMILES | NCC1CCCCN1S(=O)(=O)NCCOc1ccccc1 |
| InChI | InChI=1S/C14H23N3O3S/c15-12-13-6-4-5-10-17(13)21(18,19)16-9-11-20-14-7-2-1-3-8-14/h1-3,7-8,13,16H,4-6,9-12,15H2 |
| InChIKey | ZUYTYFJNZHXLKO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|