C10H20F3N3O2S — CID 115522853
2-(aminomethyl)-N-(4,4,4-trifluorobutyl)piperidine-1-sulfonamide (PubChem CID 115522853) has the molecular formula C10H20F3N3O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(4,4,4-trifluorobutyl)piperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-(4,4,4-trifluorobutyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 115522853 |
| Molecular Formula | C10H20F3N3O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-(aminomethyl)-N-(4,4,4-trifluorobutyl)piperidine-1-sulfonamide |
| SMILES | NCC1CCCCN1S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C10H20F3N3O2S/c11-10(12,13)5-3-6-15-19(17,18)16-7-2-1-4-9(16)8-14/h9,15H,1-8,14H2 |
| InChIKey | DTMYMKIJKJZRBC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|