C12H20ClN3O2S2 — CID 106095206
2-(aminomethyl)-N-[2-(5-chlorothiophen-2-yl)ethyl]piperidine-1-sulfonamide (PubChem CID 106095206) has the molecular formula C12H20ClN3O2S2 and a molecular weight of 337.90 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(5-chlorothiophen-2-yl)ethyl]piperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-[2-(5-chlorothiophen-2-yl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106095206 |
| Molecular Formula | C12H20ClN3O2S2 |
| Molecular Weight | 337.90 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(5-chlorothiophen-2-yl)ethyl]piperidine-1-sulfonamide |
| SMILES | NCC1CCCCN1S(=O)(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H20ClN3O2S2/c13-12-5-4-11(19-12)6-7-15-20(17,18)16-8-2-1-3-10(16)9-14/h4-5,10,15H,1-3,6-9,14H2 |
| InChIKey | RPPJXNRTAPUNFM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.90 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |