C11H25N3O4S — CID 106051256
2-(aminomethyl)-N-[2-(2-methoxyethoxy)ethyl]piperidine-1-sulfonamide (PubChem CID 106051256) has the molecular formula C11H25N3O4S and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(2-methoxyethoxy)ethyl]piperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-[2-(2-methoxyethoxy)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106051256 |
| Molecular Formula | C11H25N3O4S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(2-methoxyethoxy)ethyl]piperidine-1-sulfonamide |
| SMILES | COCCOCCNS(=O)(=O)N1CCCCC1CN |
| InChI | InChI=1S/C11H25N3O4S/c1-17-8-9-18-7-5-13-19(15,16)14-6-3-2-4-11(14)10-12/h11,13H,2-10,12H2,1H3 |
| InChIKey | YPQHWNHPHFWHDD-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|